C18H20ClN5O2 — CID 162735373
5-chloro-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-7-(ethylamino)imidazo[4,5-b]pyridine-6-carbonitrile (PubChem CID 162735373) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-chloro-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-7-(ethylamino)imidazo[4,5-b]pyridine-6-carbonitrile.
| Compound Name | 5-chloro-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-7-(ethylamino)imidazo[4,5-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 162735373 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 5-chloro-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-7-(ethylamino)imidazo[4,5-b]pyridine-6-carbonitrile |
| SMILES | CCNc1c(C#N)c(Cl)nc2c1ncn2[C@@H]1[C@H]2C[C@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H20ClN5O2/c1-4-21-11-10(6-20)16(19)23-17-12(11)22-7-24(17)13-8-5-9(8)14-15(13)26-18(2,3)25-14/h7-9,13-15H,4-5H2,1-3H3,(H,21,23)/t8-,9+,13+,14+,15-/m0/s1 |
| InChIKey | CWPVXWUEZGTCCJ-LFNVJSRFSA-N |
| XLogP | 3.10 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|