C23H24F2N4O2 — CID 162735467
N-[(2,5-difluorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-5-methylimidazo[4,5-b]pyridin-7-amine (PubChem CID 162735467) has the molecular formula C23H24F2N4O2 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-5-methylimidazo[4,5-b]pyridin-7-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-5-methylimidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162735467 |
| Molecular Formula | C23H24F2N4O2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-5-methylimidazo[4,5-b]pyridin-7-amine |
| SMILES | Cc1cc(NCc2cc(F)ccc2F)c2ncn([C@@H]3[C@H]4C[C@H]4[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C23H24F2N4O2/c1-11-6-17(26-9-12-7-13(24)4-5-16(12)25)18-22(28-11)29(10-27-18)19-14-8-15(14)20-21(19)31-23(2,3)30-20/h4-7,10,14-15,19-21H,8-9H2,1-3H3,(H,26,28)/t14-,15+,19+,20+,21-/m0/s1 |
| InChIKey | HXEHRBXLNCCNNW-LFDFRMOKSA-N |
| XLogP | 4.34 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |