C16H25Cl2N3O2 — CID 162735522
5,7-dichloro-3-cyclopentylimidazo[4,5-b]pyridine;ethane;propane-2,2-diol (PubChem CID 162735522) has the molecular formula C16H25Cl2N3O2 and a molecular weight of 362.30 g/mol. Its IUPAC name is 5,7-dichloro-3-cyclopentylimidazo[4,5-b]pyridine;ethane;propane-2,2-diol.
| Compound Name | 5,7-dichloro-3-cyclopentylimidazo[4,5-b]pyridine;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 162735522 |
| Molecular Formula | C16H25Cl2N3O2 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5,7-dichloro-3-cyclopentylimidazo[4,5-b]pyridine;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.Clc1cc(Cl)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C11H11Cl2N3.C3H8O2.C2H6/c12-8-5-9(13)15-11-10(8)14-6-16(11)7-3-1-2-4-7;1-3(2,4)5;1-2/h5-7H,1-4H2;4-5H,1-2H3;1-2H3 |
| InChIKey | DJZHHLBASOXTFP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|