C27H35FN4O2S — CID 162735551
5-fluoro-2-(4-methylsulfonylphenyl)-6-[1-(1-propan-2-ylpiperidin-4-yl)piperidin-4-yl]imidazo[1,2-a]pyridine (PubChem CID 162735551) has the molecular formula C27H35FN4O2S and a molecular weight of 498.67 g/mol. Its IUPAC name is 5-fluoro-2-(4-methylsulfonylphenyl)-6-[1-(1-propan-2-ylpiperidin-4-yl)piperidin-4-yl]imidazo[1,2-a]pyridine.
| Compound Name | 5-fluoro-2-(4-methylsulfonylphenyl)-6-[1-(1-propan-2-ylpiperidin-4-yl)piperidin-4-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 162735551 |
| Molecular Formula | C27H35FN4O2S |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 5-fluoro-2-(4-methylsulfonylphenyl)-6-[1-(1-propan-2-ylpiperidin-4-yl)piperidin-4-yl]imidazo[1,2-a]pyridine |
| SMILES | CC(C)N1CCC(N2CCC(c3ccc4nc(-c5ccc(S(C)(=O)=O)cc5)cn4c3F)CC2)CC1 |
| InChI | InChI=1S/C27H35FN4O2S/c1-19(2)30-16-12-22(13-17-30)31-14-10-20(11-15-31)24-8-9-26-29-25(18-32(26)27(24)28)21-4-6-23(7-5-21)35(3,33)34/h4-9,18-20,22H,10-17H2,1-3H3 |
| InChIKey | HAAFAEXKIXNRQF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|