About 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one
8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 162736627) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
Molecular Properties
| Compound Name | 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| PubChem CID | 162736627 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | COCC12CCCN1C(=O)CC2 |
| InChI | InChI=1S/C9H15NO2/c1-12-7-9-4-2-6-10(9)8(11)3-5-9/h2-7H2,1H3 |
| InChIKey | FILVWAKPWRERMK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CID 162736627) is 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is COCC12CCCN1C(=O)CC2.
What is the InChIKey of 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is FILVWAKPWRERMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-12-7-9-4-2-6-10(9)8(11)3-5-9/h2-7H2,1H3.
What are the key properties of 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 169.22 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(methoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 162736627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).