About O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine
O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine (PubChem CID 162736628) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine |
| PubChem CID | 162736628 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine |
| SMILES | CN1CCC2(CN(C)C2)C(CON)C1 |
| InChI | InChI=1S/C10H21N3O/c1-12-4-3-10(7-13(2)8-10)9(5-12)6-14-11/h9H,3-8,11H2,1-2H3 |
| InChIKey | JKRIVUPPRKUZQI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine?
The IUPAC name of O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine (CID 162736628) is O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine.
What is the SMILES notation for O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine?
The canonical SMILES for O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine is CN1CCC2(CN(C)C2)C(CON)C1.
What is the InChIKey of O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine?
The InChIKey is JKRIVUPPRKUZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O/c1-12-4-3-10(7-13(2)8-10)9(5-12)6-14-11/h9H,3-8,11H2,1-2H3.
What are the key properties of O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine?
O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine has a molecular weight of 199.30 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(2,7-dimethyl-2,7-diazaspiro[3.5]nonan-5-yl)methyl]hydroxylamine is sourced from PubChem (CID 162736628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).