C20H28N2O — CID 162736855
ethane;(1E)-2-ethyl-N-[2-(6-methoxyquinolin-4-yl)ethyl]buta-1,3-dien-1-amine (PubChem CID 162736855) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is ethane;(1E)-2-ethyl-N-[2-(6-methoxyquinolin-4-yl)ethyl]buta-1,3-dien-1-amine.
| Compound Name | ethane;(1E)-2-ethyl-N-[2-(6-methoxyquinolin-4-yl)ethyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 162736855 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | ethane;(1E)-2-ethyl-N-[2-(6-methoxyquinolin-4-yl)ethyl]buta-1,3-dien-1-amine |
| SMILES | C=C/C(=C/NCCc1ccnc2ccc(OC)cc12)CC.CC |
| InChI | InChI=1S/C18H22N2O.C2H6/c1-4-14(5-2)13-19-10-8-15-9-11-20-18-7-6-16(21-3)12-17(15)18;1-2/h4,6-7,9,11-13,19H,1,5,8,10H2,2-3H3;1-2H3/b14-13-; |
| InChIKey | JDHVTRKVVSVGGT-HPWRNOGASA-N |
| XLogP | 4.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|