C20H24N2 — CID 162737704
2-piperidin-4-yl-6-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine (PubChem CID 162737704) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-piperidin-4-yl-6-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine.
| Compound Name | 2-piperidin-4-yl-6-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine |
|---|---|
| PubChem CID | 162737704 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-piperidin-4-yl-6-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine |
| SMILES | c1cc(C2CCNCC2)nc(C2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C20H24N2/c1-2-5-17-14-18(9-8-15(17)4-1)20-7-3-6-19(22-20)16-10-12-21-13-11-16/h1-7,16,18,21H,8-14H2 |
| InChIKey | IAVKSQICJYRHHU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |