C18H23N3O2 — CID 162738369
3-(4-hydroxyphenyl)propanal;N-[(E)-1-(6-methyl-2-pyridinyl)ethylideneamino]methanamine (PubChem CID 162738369) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)propanal;N-[(E)-1-(6-methyl-2-pyridinyl)ethylideneamino]methanamine.
| Compound Name | 3-(4-hydroxyphenyl)propanal;N-[(E)-1-(6-methyl-2-pyridinyl)ethylideneamino]methanamine |
|---|---|
| PubChem CID | 162738369 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-(4-hydroxyphenyl)propanal;N-[(E)-1-(6-methyl-2-pyridinyl)ethylideneamino]methanamine |
| SMILES | CN/N=C(\C)c1cccc(C)n1.O=CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13N3.C9H10O2/c1-7-5-4-6-9(11-7)8(2)12-10-3;10-7-1-2-8-3-5-9(11)6-4-8/h4-6,10H,1-3H3;3-7,11H,1-2H2/b12-8+; |
| InChIKey | LNVXCHYEQMEBPP-MXZHIVQLSA-N |
| XLogP | 2.86 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|