C21H22F4N4O2 — CID 162738908
[(5aR,8aS)-4,5,5a,6,8,8a-hexahydro-1H-pyrrolo[3,4-g]indazol-7-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone (PubChem CID 162738908) has the molecular formula C21H22F4N4O2 and a molecular weight of 438.43 g/mol. Its IUPAC name is [(5aR,8aS)-4,5,5a,6,8,8a-hexahydro-1H-pyrrolo[3,4-g]indazol-7-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone.
| Compound Name | [(5aR,8aS)-4,5,5a,6,8,8a-hexahydro-1H-pyrrolo[3,4-g]indazol-7-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 162738908 |
| Molecular Formula | C21H22F4N4O2 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [(5aR,8aS)-4,5,5a,6,8,8a-hexahydro-1H-pyrrolo[3,4-g]indazol-7-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone |
| SMILES | O=C(N1CC(OCc2ccc(C(F)(F)F)cc2F)C1)N1C[C@@H]2CCc3cn[nH]c3[C@@H]2C1 |
| InChI | InChI=1S/C21H22F4N4O2/c22-18-5-15(21(23,24)25)4-3-14(18)11-31-16-8-29(9-16)20(30)28-7-13-2-1-12-6-26-27-19(12)17(13)10-28/h3-6,13,16-17H,1-2,7-11H2,(H,26,27)/t13-,17+/m0/s1 |
| InChIKey | XUEDJLJUDJCFBM-SUMWQHHRSA-N |
| XLogP | 3.55 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |