C7H12N3OP — CID 162738915
(1S,9R)-8-oxa-3,5,11-triaza-4-phosphatricyclo[7.3.0.02,6]dodec-2(6)-ene (PubChem CID 162738915) has the molecular formula C7H12N3OP and a molecular weight of 185.17 g/mol. Its IUPAC name is (1S,9R)-8-oxa-3,5,11-triaza-4-phosphatricyclo[7.3.0.02,6]dodec-2(6)-ene.
| Compound Name | (1S,9R)-8-oxa-3,5,11-triaza-4-phosphatricyclo[7.3.0.02,6]dodec-2(6)-ene |
|---|---|
| PubChem CID | 162738915 |
| Molecular Formula | C7H12N3OP |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (1S,9R)-8-oxa-3,5,11-triaza-4-phosphatricyclo[7.3.0.02,6]dodec-2(6)-ene |
| SMILES | C1O[C@H]2CNC[C@H]2C2=C1NPN2 |
| InChI | InChI=1S/C7H12N3OP/c1-4-6(2-8-1)11-3-5-7(4)10-12-9-5/h4,6,8-10,12H,1-3H2/t4-,6+/m1/s1 |
| InChIKey | GUKUFKWRMFXMMU-XINAWCOVSA-N |
| XLogP | -0.48 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|