About 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid
4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid (PubChem CID 162739679) has the molecular formula C16H13FN6O2
and a molecular weight of 340.32 g/mol. Its IUPAC name is 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid |
| PubChem CID | 162739679 |
| Molecular Formula | C16H13FN6O2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid |
| SMILES | Nc1nn(-c2ccc(C(=O)O)cc2)c(N)c1/N=N/c1ccccc1F |
| InChI | InChI=1S/C16H13FN6O2/c17-11-3-1-2-4-12(11)20-21-13-14(18)22-23(15(13)19)10-7-5-9(6-8-10)16(24)25/h1-8H,19H2,(H2,18,22)(H,24,25)/b21-20+ |
| InChIKey | QYGXIDQVGLOEFT-QZQOTICOSA-N |
| XLogP | 3.29 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid?
The IUPAC name of 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid (CID 162739679) is 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid.
What is the SMILES notation for 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid?
The canonical SMILES for 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid is Nc1nn(-c2ccc(C(=O)O)cc2)c(N)c1/N=N/c1ccccc1F.
What is the InChIKey of 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid?
The InChIKey is QYGXIDQVGLOEFT-QZQOTICOSA-N. The full InChI is InChI=1S/C16H13FN6O2/c17-11-3-1-2-4-12(11)20-21-13-14(18)22-23(15(13)19)10-7-5-9(6-8-10)16(24)25/h1-8H,19H2,(H2,18,22)(H,24,25)/b21-20+.
What are the key properties of 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid?
4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid has a molecular weight of 340.32 g/mol, XLogP of 3.29, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-diamino-4-[(2-fluorophenyl)diazenyl]pyrazol-1-yl]benzoic acid is sourced from PubChem (CID 162739679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).