C14H24F3N — CID 162740143
1,1-dicyclohexyl-2,2,2-trifluoroethanamine (PubChem CID 162740143) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is 1,1-dicyclohexyl-2,2,2-trifluoroethanamine.
| Compound Name | 1,1-dicyclohexyl-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 162740143 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1,1-dicyclohexyl-2,2,2-trifluoroethanamine |
| SMILES | NC(C1CCCCC1)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N/c15-14(16,17)13(18,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10,18H2 |
| InChIKey | ALTOBZOLHCXAEW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |