C38H25BF23N — CID 162740144
dicyclohexyl(2,2,2-trifluoroethyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 162740144) has the molecular formula C38H25BF23N and a molecular weight of 943.39 g/mol. Its IUPAC name is dicyclohexyl(2,2,2-trifluoroethyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | dicyclohexyl(2,2,2-trifluoroethyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 162740144 |
| Molecular Formula | C38H25BF23N |
| Molecular Weight | 943.39 g/mol |
| Exact Mass | 943.17 |
| IUPAC Name | dicyclohexyl(2,2,2-trifluoroethyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | FC(F)(F)C[NH+](C1CCCCC1)C1CCCCC1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C14H24F3N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-14(16,17)11-18(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h;12-13H,1-11H2/q-1;/p+1 |
| InChIKey | SQYHOISYTKTICI-UHFFFAOYSA-O |
| XLogP | 8.94 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.39 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|