C32H51FN2O — CID 162740253
ethane;(7E)-3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[(E)-[(5E)-3-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-ylidene]hydrazinylidene]octan-2-one (PubChem CID 162740253) has the molecular formula C32H51FN2O and a molecular weight of 498.77 g/mol. Its IUPAC name is ethane;(7E)-3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[(E)-[(5E)-3-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-ylidene]hydrazinylidene]octan-2-one.
| Compound Name | ethane;(7E)-3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[(E)-[(5E)-3-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-ylidene]hydrazinylidene]octan-2-one |
|---|---|
| PubChem CID | 162740253 |
| Molecular Formula | C32H51FN2O |
| Molecular Weight | 498.77 g/mol |
| Exact Mass | 498.40 |
| IUPAC Name | ethane;(7E)-3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[(E)-[(5E)-3-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-ylidene]hydrazinylidene]octan-2-one |
| SMILES | C=C/C=C(\C=C/C)C(=N/N=C(\C)CCCC(CC1=CC(F)C(=C)C=C1)C(C)=O)/C(C)CC.CC.CC |
| InChI | InChI=1S/C28H39FN2O.2C2H6/c1-8-12-25(13-9-2)28(20(4)10-3)31-30-22(6)14-11-15-26(23(7)32)18-24-17-16-21(5)27(29)19-24;2*1-2/h8-9,12-13,16-17,19-20,26-27H,1,5,10-11,14-15,18H2,2-4,6-7H3;2*1-2H3/b13-9-,25-12+,30-22+,31-28+;; |
| InChIKey | GLDBUKDWBDBWMZ-DMOOHVLTSA-N |
| XLogP | 9.75 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.77 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|