C22H30N8O2 — CID 162740601
(2S)-6-amino-2-[[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]hexanamide (PubChem CID 162740601) has the molecular formula C22H30N8O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]hexanamide.
| Compound Name | (2S)-6-amino-2-[[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]hexanamide |
|---|---|
| PubChem CID | 162740601 |
| Molecular Formula | C22H30N8O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2S)-6-amino-2-[[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]hexanamide |
| SMILES | CC(C)n1ncnc1-c1cn2c(n1)-c1ccc(N[C@@H](CCCCN)C(N)=O)cc1OCC2 |
| InChI | InChI=1S/C22H30N8O2/c1-14(2)30-22(25-13-26-30)18-12-29-9-10-32-19-11-15(6-7-16(19)21(29)28-18)27-17(20(24)31)5-3-4-8-23/h6-7,11-14,17,27H,3-5,8-10,23H2,1-2H3,(H2,24,31)/t17-/m0/s1 |
| InChIKey | CVZUAXBWJLOWBS-KRWDZBQOSA-N |
| XLogP | 2.18 |
| TPSA | 138.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|