C16H22O2 — CID 162740735
ethylbenzene;3-propylcyclopentane-1,2-dione (PubChem CID 162740735) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is ethylbenzene;3-propylcyclopentane-1,2-dione.
| Compound Name | ethylbenzene;3-propylcyclopentane-1,2-dione |
|---|---|
| PubChem CID | 162740735 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethylbenzene;3-propylcyclopentane-1,2-dione |
| SMILES | CCCC1CCC(=O)C1=O.CCc1ccccc1 |
| InChI | InChI=1S/C8H12O2.C8H10/c1-2-3-6-4-5-7(9)8(6)10;1-2-8-6-4-3-5-7-8/h6H,2-5H2,1H3;3-7H,2H2,1H3 |
| InChIKey | ZUPWFTPAZGCEJD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|