C19H26N2O3 — CID 162740997
methanol;1-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carbaldehyde (PubChem CID 162740997) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is methanol;1-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carbaldehyde.
| Compound Name | methanol;1-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 162740997 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methanol;1-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carbaldehyde |
| SMILES | CO.Cc1cccc(-c2nc(CN3CCC(C=O)CC3)c(C)o2)c1 |
| InChI | InChI=1S/C18H22N2O2.CH4O/c1-13-4-3-5-16(10-13)18-19-17(14(2)22-18)11-20-8-6-15(12-21)7-9-20;1-2/h3-5,10,12,15H,6-9,11H2,1-2H3;2H,1H3 |
| InChIKey | HCBCTDYVRBHANH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|