C11H22N3+ — CID 162741958
(3aS,6aR)-5-(azetidin-1-ium-3-ylmethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 162741958) has the molecular formula C11H22N3+ and a molecular weight of 196.32 g/mol. Its IUPAC name is (3aS,6aR)-5-(azetidin-1-ium-3-ylmethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-(azetidin-1-ium-3-ylmethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 162741958 |
| Molecular Formula | C11H22N3+ |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (3aS,6aR)-5-(azetidin-1-ium-3-ylmethyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1C[C@@H]2CN(CC3C[NH2+]C3)C[C@@H]2C1 |
| InChI | InChI=1S/C11H21N3/c1-13-5-10-7-14(8-11(10)6-13)4-9-2-12-3-9/h9-12H,2-8H2,1H3/p+1/t10-,11+ |
| InChIKey | OHZDDYCOGUYVKY-PHIMTYICSA-O |
| XLogP | -1.33 |
| TPSA | 23.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |