C25H30FN7O4S — CID 162743186
7-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,1-dioxothian-4-yl)oxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-fluoro-1,3-benzoxazol-2-amine (PubChem CID 162743186) has the molecular formula C25H30FN7O4S and a molecular weight of 543.63 g/mol. Its IUPAC name is 7-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,1-dioxothian-4-yl)oxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-fluoro-1,3-benzoxazol-2-amine.
| Compound Name | 7-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,1-dioxothian-4-yl)oxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-fluoro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 162743186 |
| Molecular Formula | C25H30FN7O4S |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 7-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,1-dioxothian-4-yl)oxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-4-fluoro-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2c(F)ccc(N3CCc4c(nc(OC5CCS(=O)(=O)CC5)nc4N4CC5CCC(C4)N5)C3)c2o1 |
| InChI | InChI=1S/C25H30FN7O4S/c26-18-3-4-20(22-21(18)30-24(27)37-22)32-8-5-17-19(13-32)29-25(36-16-6-9-38(34,35)10-7-16)31-23(17)33-11-14-1-2-15(12-33)28-14/h3-4,14-16,28H,1-2,5-13H2,(H2,27,30) |
| InChIKey | FTWZZCABHAYLCH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |