C34H39FN6O4S — CID 162743540
tert-butyl 4-[4-[(2R)-2-[2-[[1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carbonyl]amino]-1,3-thiazol-4-yl]pyrrolidin-1-yl]phenoxy]piperidine-1-carboxylate (PubChem CID 162743540) has the molecular formula C34H39FN6O4S and a molecular weight of 646.79 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2R)-2-[2-[[1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carbonyl]amino]-1,3-thiazol-4-yl]pyrrolidin-1-yl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2R)-2-[2-[[1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carbonyl]amino]-1,3-thiazol-4-yl]pyrrolidin-1-yl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162743540 |
| Molecular Formula | C34H39FN6O4S |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | tert-butyl 4-[4-[(2R)-2-[2-[[1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carbonyl]amino]-1,3-thiazol-4-yl]pyrrolidin-1-yl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(N3CCC[C@@H]3c3csc(NC(=O)c4cccn4Cc4ccnc(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C34H39FN6O4S/c1-34(2,3)45-33(43)39-18-13-26(14-19-39)44-25-10-8-24(9-11-25)41-17-5-6-28(41)27-22-46-32(37-27)38-31(42)29-7-4-16-40(29)21-23-12-15-36-30(35)20-23/h4,7-12,15-16,20,22,26,28H,5-6,13-14,17-19,21H2,1-3H3,(H,37,38,42)/t28-/m1/s1 |
| InChIKey | FRTNNAZVSWVSDH-MUUNZHRXSA-N |
| XLogP | 6.90 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|