About N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide
N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide (PubChem CID 162743697) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide.
Molecular Properties
| Compound Name | N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide |
| PubChem CID | 162743697 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide |
| SMILES | O=CNc1nc(C2CCCN2c2ccccc2)cs1 |
| InChI | InChI=1S/C14H15N3OS/c18-10-15-14-16-12(9-19-14)13-7-4-8-17(13)11-5-2-1-3-6-11/h1-3,5-6,9-10,13H,4,7-8H2,(H,15,16,18) |
| InChIKey | OFUCBMYZYGOSJP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide?
The IUPAC name of N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide (CID 162743697) is N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide.
What is the SMILES notation for N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide?
The canonical SMILES for N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide is O=CNc1nc(C2CCCN2c2ccccc2)cs1.
What is the InChIKey of N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide?
The InChIKey is OFUCBMYZYGOSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS/c18-10-15-14-16-12(9-19-14)13-7-4-8-17(13)11-5-2-1-3-6-11/h1-3,5-6,9-10,13H,4,7-8H2,(H,15,16,18).
What are the key properties of N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide?
N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide has a molecular weight of 273.36 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]formamide is sourced from PubChem (CID 162743697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).