C25H21FN6OS — CID 162743798
4-cyano-1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide (PubChem CID 162743798) has the molecular formula C25H21FN6OS and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-cyano-1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide.
| Compound Name | 4-cyano-1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743798 |
| Molecular Formula | C25H21FN6OS |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-cyano-1-[(2-fluoro-4-pyridinyl)methyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
| SMILES | N#Cc1cc(C(=O)Nc2nc([C@H]3CCCN3c3ccccc3)cs2)n(Cc2ccnc(F)c2)c1 |
| InChI | InChI=1S/C25H21FN6OS/c26-23-12-17(8-9-28-23)14-31-15-18(13-27)11-22(31)24(33)30-25-29-20(16-34-25)21-7-4-10-32(21)19-5-2-1-3-6-19/h1-3,5-6,8-9,11-12,15-16,21H,4,7,10,14H2,(H,29,30,33)/t21-/m1/s1 |
| InChIKey | PUDOEZKQGPOWSZ-OAQYLSRUSA-N |
| XLogP | 4.99 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|