C33H37FN6O2S — CID 162743857
N-[4-[(2R)-1-[4-[1-(1-acetylpiperidin-4-yl)ethyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide (PubChem CID 162743857) has the molecular formula C33H37FN6O2S and a molecular weight of 600.76 g/mol. Its IUPAC name is N-[4-[(2R)-1-[4-[1-(1-acetylpiperidin-4-yl)ethyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide.
| Compound Name | N-[4-[(2R)-1-[4-[1-(1-acetylpiperidin-4-yl)ethyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743857 |
| Molecular Formula | C33H37FN6O2S |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | N-[4-[(2R)-1-[4-[1-(1-acetylpiperidin-4-yl)ethyl]phenyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]-1-[(2-fluoro-4-pyridinyl)methyl]pyrrole-2-carboxamide |
| SMILES | CC(=O)N1CCC(C(C)c2ccc(N3CCC[C@@H]3c3csc(NC(=O)c4cccn4Cc4ccnc(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C33H37FN6O2S/c1-22(26-12-17-38(18-13-26)23(2)41)25-7-9-27(10-8-25)40-16-4-5-29(40)28-21-43-33(36-28)37-32(42)30-6-3-15-39(30)20-24-11-14-35-31(34)19-24/h3,6-11,14-15,19,21-22,26,29H,4-5,12-13,16-18,20H2,1-2H3,(H,36,37,42)/t22?,29-/m1/s1 |
| InChIKey | SVBIOUNQKXBCLV-OLVCOQPYSA-N |
| XLogP | 6.48 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|