C32H54O — CID 162744110
(14Z,17Z,20Z,23Z,26Z,29Z)-3,3-dideuteriodotriaconta-14,17,20,23,26,29-hexaen-1-ol (PubChem CID 162744110) has the molecular formula C32H54O and a molecular weight of 456.80 g/mol. Its IUPAC name is (14Z,17Z,20Z,23Z,26Z,29Z)-3,3-dideuteriodotriaconta-14,17,20,23,26,29-hexaen-1-ol.
| Compound Name | (14Z,17Z,20Z,23Z,26Z,29Z)-3,3-dideuteriodotriaconta-14,17,20,23,26,29-hexaen-1-ol |
|---|---|
| PubChem CID | 162744110 |
| Molecular Formula | C32H54O |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.43 |
| IUPAC Name | (14Z,17Z,20Z,23Z,26Z,29Z)-3,3-dideuteriodotriaconta-14,17,20,23,26,29-hexaen-1-ol |
| SMILES | [2H]C([2H])(CCO)CCCCCCCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C32H54O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33/h3-4,6-7,9-10,12-13,15-16,18-19,33H,2,5,8,11,14,17,20-32H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/i30D2 |
| InChIKey | XLKSRDFTWSGSGI-OLARFQGLSA-N |
| XLogP | 10.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|