C16H25BrO — CID 162744112
(9-bromo-9,9-dideuteriononoxy)methylbenzene (PubChem CID 162744112) has the molecular formula C16H25BrO and a molecular weight of 315.29 g/mol. Its IUPAC name is (9-bromo-9,9-dideuteriononoxy)methylbenzene.
| Compound Name | (9-bromo-9,9-dideuteriononoxy)methylbenzene |
|---|---|
| PubChem CID | 162744112 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (9-bromo-9,9-dideuteriononoxy)methylbenzene |
| SMILES | [2H]C([2H])(Br)CCCCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C16H25BrO/c17-13-9-4-2-1-3-5-10-14-18-15-16-11-7-6-8-12-16/h6-8,11-12H,1-5,9-10,13-15H2/i13D2 |
| InChIKey | GAWPLFRGGVSXPU-KLTYLHELSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|