About 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol
3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol (PubChem CID 162744237) has the molecular formula C20H29F5O2S
and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol.
Molecular Properties
| Compound Name | 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol |
| PubChem CID | 162744237 |
| Molecular Formula | C20H29F5O2S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol |
| SMILES | OCCCOCCCCCCCCCC#Cc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C20H29F5O2S/c21-28(22,23,24,25)20-14-12-19(13-15-20)11-8-6-4-2-1-3-5-7-9-17-27-18-10-16-26/h12-15,26H,1-7,9-10,16-18H2 |
| InChIKey | RDXAEYGMGNVHAU-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol?
The IUPAC name of 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol (CID 162744237) is 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol.
What is the SMILES notation for 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol?
The canonical SMILES for 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol is OCCCOCCCCCCCCCC#Cc1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol?
The InChIKey is RDXAEYGMGNVHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29F5O2S/c21-28(22,23,24,25)20-14-12-19(13-15-20)11-8-6-4-2-1-3-5-7-9-17-27-18-10-16-26/h12-15,26H,1-7,9-10,16-18H2.
What are the key properties of 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol?
3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol has a molecular weight of 428.51 g/mol, XLogP of 7.22, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol is sourced from PubChem (CID 162744237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).