C20H29F5O2S — CID 162744237
3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol (PubChem CID 162744237) has the molecular formula C20H29F5O2S and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol.
| Compound Name | 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol |
|---|---|
| PubChem CID | 162744237 |
| Molecular Formula | C20H29F5O2S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-ol |
| SMILES | OCCCOCCCCCCCCCC#Cc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C20H29F5O2S/c21-28(22,23,24,25)20-14-12-19(13-15-20)11-8-6-4-2-1-3-5-7-9-17-27-18-10-16-26/h12-15,26H,1-7,9-10,16-18H2 |
| InChIKey | RDXAEYGMGNVHAU-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|