C22H42OS2 — CID 162744274
(3Z)-16-(3-ethoxypropylsulfanyl)-4-methylsulfanylhexadeca-1,3-diene (PubChem CID 162744274) has the molecular formula C22H42OS2 and a molecular weight of 386.71 g/mol. Its IUPAC name is (3Z)-16-(3-ethoxypropylsulfanyl)-4-methylsulfanylhexadeca-1,3-diene.
| Compound Name | (3Z)-16-(3-ethoxypropylsulfanyl)-4-methylsulfanylhexadeca-1,3-diene |
|---|---|
| PubChem CID | 162744274 |
| Molecular Formula | C22H42OS2 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (3Z)-16-(3-ethoxypropylsulfanyl)-4-methylsulfanylhexadeca-1,3-diene |
| SMILES | C=C/C=C(/CCCCCCCCCCCCSCCCOCC)SC |
| InChI | InChI=1S/C22H42OS2/c1-4-17-22(24-3)18-14-12-10-8-6-7-9-11-13-15-20-25-21-16-19-23-5-2/h4,17H,1,5-16,18-21H2,2-3H3/b22-17- |
| InChIKey | CBPDGCMSDBJQDA-XLNRJJMWSA-N |
| XLogP | 7.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|