C22H31F5OSSi — CID 162744387
3-[11-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]undec-10-ynylsulfanyl]propan-1-ol (PubChem CID 162744387) has the molecular formula C22H31F5OSSi and a molecular weight of 466.63 g/mol. Its IUPAC name is 3-[11-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]undec-10-ynylsulfanyl]propan-1-ol.
| Compound Name | 3-[11-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]undec-10-ynylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 162744387 |
| Molecular Formula | C22H31F5OSSi |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-[11-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]undec-10-ynylsulfanyl]propan-1-ol |
| SMILES | C[Si](C)(C#CCCCCCCCCCSCCCO)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H31F5OSSi/c1-30(2,22-20(26)18(24)17(23)19(25)21(22)27)16-11-9-7-5-3-4-6-8-10-14-29-15-12-13-28/h28H,3-10,12-15H2,1-2H3 |
| InChIKey | YBQRRGGXUNXNFQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|