C41H52INO9 — CID 162745419
[(1S)-3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)propyl] (2R)-1-[(2S)-2-cyclohexyl-2-[3-(2-iodoethoxy)-4,5-dimethoxyphenyl]acetyl]piperidine-2-carboxylate (PubChem CID 162745419) has the molecular formula C41H52INO9 and a molecular weight of 829.77 g/mol. Its IUPAC name is [(1S)-3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)propyl] (2R)-1-[(2S)-2-cyclohexyl-2-[3-(2-iodoethoxy)-4,5-dimethoxyphenyl]acetyl]piperidine-2-carboxylate.
| Compound Name | [(1S)-3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)propyl] (2R)-1-[(2S)-2-cyclohexyl-2-[3-(2-iodoethoxy)-4,5-dimethoxyphenyl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 162745419 |
| Molecular Formula | C41H52INO9 |
| Molecular Weight | 829.77 g/mol |
| Exact Mass | 829.27 |
| IUPAC Name | [(1S)-3-(3,4-dimethoxyphenyl)-1-(3-hydroxyphenyl)propyl] (2R)-1-[(2S)-2-cyclohexyl-2-[3-(2-iodoethoxy)-4,5-dimethoxyphenyl]acetyl]piperidine-2-carboxylate |
| SMILES | COc1ccc(CC[C@H](OC(=O)[C@H]2CCCCN2C(=O)[C@H](c2cc(OC)c(OC)c(OCCI)c2)C2CCCCC2)c2cccc(O)c2)cc1OC |
| InChI | InChI=1S/C41H52INO9/c1-47-34-19-17-27(23-35(34)48-2)16-18-33(29-13-10-14-31(44)24-29)52-41(46)32-15-8-9-21-43(32)40(45)38(28-11-6-5-7-12-28)30-25-36(49-3)39(50-4)37(26-30)51-22-20-42/h10,13-14,17,19,23-26,28,32-33,38,44H,5-9,11-12,15-16,18,20-22H2,1-4H3/t32-,33+,38+/m1/s1 |
| InChIKey | SSMXSXAVZWQSCW-GQNZDDNNSA-N |
| XLogP | 8.20 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|