C20H27N3O5S — CID 162745804
(4R)-4-[3-[3-[4-[3-(methylsulfonylmethyl)azetidin-1-yl]phenyl]azetidin-1-yl]-3-oxopropyl]-1,3-oxazolidin-2-one (PubChem CID 162745804) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is (4R)-4-[3-[3-[4-[3-(methylsulfonylmethyl)azetidin-1-yl]phenyl]azetidin-1-yl]-3-oxopropyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[3-[3-[4-[3-(methylsulfonylmethyl)azetidin-1-yl]phenyl]azetidin-1-yl]-3-oxopropyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162745804 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (4R)-4-[3-[3-[4-[3-(methylsulfonylmethyl)azetidin-1-yl]phenyl]azetidin-1-yl]-3-oxopropyl]-1,3-oxazolidin-2-one |
| SMILES | CS(=O)(=O)CC1CN(c2ccc(C3CN(C(=O)CC[C@@H]4COC(=O)N4)C3)cc2)C1 |
| InChI | InChI=1S/C20H27N3O5S/c1-29(26,27)13-14-8-22(9-14)18-5-2-15(3-6-18)16-10-23(11-16)19(24)7-4-17-12-28-20(25)21-17/h2-3,5-6,14,16-17H,4,7-13H2,1H3,(H,21,25)/t17-/m1/s1 |
| InChIKey | XSAGVSKRGAPOAD-QGZVFWFLSA-N |
| XLogP | 0.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|