C9H5F2NO4 — CID 162746312
2,2-difluoro-6-hydroxy-5H-[1,3]dioxolo[4,5-f]isoindol-7-one (PubChem CID 162746312) has the molecular formula C9H5F2NO4 and a molecular weight of 229.14 g/mol. Its IUPAC name is 2,2-difluoro-6-hydroxy-5H-[1,3]dioxolo[4,5-f]isoindol-7-one.
| Compound Name | 2,2-difluoro-6-hydroxy-5H-[1,3]dioxolo[4,5-f]isoindol-7-one |
|---|---|
| PubChem CID | 162746312 |
| Molecular Formula | C9H5F2NO4 |
| Molecular Weight | 229.14 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2,2-difluoro-6-hydroxy-5H-[1,3]dioxolo[4,5-f]isoindol-7-one |
| SMILES | O=C1c2cc3c(cc2CN1O)OC(F)(F)O3 |
| InChI | InChI=1S/C9H5F2NO4/c10-9(11)15-6-1-4-3-12(14)8(13)5(4)2-7(6)16-9/h1-2,14H,3H2 |
| InChIKey | IVEBAUMYNXWHDX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|