About N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide
N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide (PubChem CID 162746689) has the molecular formula C22H17ClN4O2S
and a molecular weight of 436.92 g/mol. Its IUPAC name is N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide.
Molecular Properties
| Compound Name | N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide |
| PubChem CID | 162746689 |
| Molecular Formula | C22H17ClN4O2S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide |
| SMILES | CC(=O)N(c1ccc2ncsc2c1)c1cc(NC(=O)Cc2ccccc2Cl)ccn1 |
| InChI | InChI=1S/C22H17ClN4O2S/c1-14(28)27(17-6-7-19-20(12-17)30-13-25-19)21-11-16(8-9-24-21)26-22(29)10-15-4-2-3-5-18(15)23/h2-9,11-13H,10H2,1H3,(H,24,26,29) |
| InChIKey | DKFJSNVNVRGJCK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide?
The IUPAC name of N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide (CID 162746689) is N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide.
What is the SMILES notation for N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide?
The canonical SMILES for N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide is CC(=O)N(c1ccc2ncsc2c1)c1cc(NC(=O)Cc2ccccc2Cl)ccn1.
What is the InChIKey of N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide?
The InChIKey is DKFJSNVNVRGJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClN4O2S/c1-14(28)27(17-6-7-19-20(12-17)30-13-25-19)21-11-16(8-9-24-21)26-22(29)10-15-4-2-3-5-18(15)23/h2-9,11-13H,10H2,1H3,(H,24,26,29).
What are the key properties of N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide?
N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide has a molecular weight of 436.92 g/mol, XLogP of 5.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[acetyl(1,3-benzothiazol-6-yl)amino]-4-pyridinyl]-2-(2-chlorophenyl)acetamide is sourced from PubChem (CID 162746689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).