About N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide
N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide (PubChem CID 162746987) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide |
| PubChem CID | 162746987 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(C)ccc(F)c1C |
| InChI | InChI=1S/C11H12FNO/c1-4-10(14)13-11-7(2)5-6-9(12)8(11)3/h4-6H,1H2,2-3H3,(H,13,14) |
| InChIKey | IOLCBRUFJRZLGA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide?
The IUPAC name of N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide (CID 162746987) is N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide.
What is the SMILES notation for N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide?
The canonical SMILES for N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide is C=CC(=O)Nc1c(C)ccc(F)c1C.
What is the InChIKey of N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide?
The InChIKey is IOLCBRUFJRZLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO/c1-4-10(14)13-11-7(2)5-6-9(12)8(11)3/h4-6H,1H2,2-3H3,(H,13,14).
What are the key properties of N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide?
N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide has a molecular weight of 193.22 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-2,6-dimethylphenyl)prop-2-enamide is sourced from PubChem (CID 162746987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).