About (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide
(E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide (PubChem CID 162747114) has the molecular formula C20H18FN3O
and a molecular weight of 335.38 g/mol. Its IUPAC name is (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide |
| PubChem CID | 162747114 |
| Molecular Formula | C20H18FN3O |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide |
| SMILES | Cc1[nH]nc2cc(/C=C/C(=O)NC3CCc4cc(F)ccc43)ccc12 |
| InChI | InChI=1S/C20H18FN3O/c1-12-16-6-2-13(10-19(16)24-23-12)3-9-20(25)22-18-8-4-14-11-15(21)5-7-17(14)18/h2-3,5-7,9-11,18H,4,8H2,1H3,(H,22,25)(H,23,24)/b9-3+ |
| InChIKey | LTWVQEFULFRSOJ-YCRREMRBSA-N |
| XLogP | 3.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide?
The IUPAC name of (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide (CID 162747114) is (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide?
The canonical SMILES for (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide is Cc1[nH]nc2cc(/C=C/C(=O)NC3CCc4cc(F)ccc43)ccc12.
What is the InChIKey of (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide?
The InChIKey is LTWVQEFULFRSOJ-YCRREMRBSA-N. The full InChI is InChI=1S/C20H18FN3O/c1-12-16-6-2-13(10-19(16)24-23-12)3-9-20(25)22-18-8-4-14-11-15(21)5-7-17(14)18/h2-3,5-7,9-11,18H,4,8H2,1H3,(H,22,25)(H,23,24)/b9-3+.
What are the key properties of (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide?
(E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide has a molecular weight of 335.38 g/mol, XLogP of 3.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide is sourced from PubChem (CID 162747114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).