C16H16N6 — CID 162747198
3,6-bis(2-pyridin-2-ylethyl)-1,2,4,5-tetrazine (PubChem CID 162747198) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 3,6-bis(2-pyridin-2-ylethyl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(2-pyridin-2-ylethyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 162747198 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3,6-bis(2-pyridin-2-ylethyl)-1,2,4,5-tetrazine |
| SMILES | c1ccc(CCc2nnc(CCc3ccccn3)nn2)nc1 |
| InChI | InChI=1S/C16H16N6/c1-3-11-17-13(5-1)7-9-15-19-21-16(22-20-15)10-8-14-6-2-4-12-18-14/h1-6,11-12H,7-10H2 |
| InChIKey | XDUYOAOLZUDBPY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |