About 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium
4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium (PubChem CID 162747593) has the molecular formula C16H19N2O4Y-
and a molecular weight of 392.24 g/mol. Its IUPAC name is 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium.
Molecular Properties
| Compound Name | 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium |
| PubChem CID | 162747593 |
| Molecular Formula | C16H19N2O4Y- |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium |
| SMILES | CC.CC(CCC(=O)NC=O)N1C(=O)c2c[c-]ccc2C1=O.[Y] |
| InChI | InChI=1S/C14H13N2O4.C2H6.Y/c1-9(6-7-12(18)15-8-17)16-13(19)10-4-2-3-5-11(10)14(16)20;1-2;/h2,4-5,8-9H,6-7H2,1H3,(H,15,17,18);1-2H3;/q-1;; |
| InChIKey | LLKOJIYGVJJPSB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium?
The IUPAC name of 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium (CID 162747593) is 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium.
What is the SMILES notation for 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium?
The canonical SMILES for 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium is CC.CC(CCC(=O)NC=O)N1C(=O)c2c[c-]ccc2C1=O.[Y].
What is the InChIKey of 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium?
The InChIKey is LLKOJIYGVJJPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N2O4.C2H6.Y/c1-9(6-7-12(18)15-8-17)16-13(19)10-4-2-3-5-11(10)14(16)20;1-2;/h2,4-5,8-9H,6-7H2,1H3,(H,15,17,18);1-2H3;/q-1;;.
What are the key properties of 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium?
4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium has a molecular weight of 392.24 g/mol, XLogP of 1.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxo-5H-isoindol-5-id-2-yl)-N-formylpentanamide;ethane;yttrium is sourced from PubChem (CID 162747593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).