C24H32N6OS — CID 162748724
(2Z)-4-methyl-1-[4-[7-(4-methylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-yl]piperidin-1-yl]-2-methylsulfanylpenta-2,4-dien-1-one (PubChem CID 162748724) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is (2Z)-4-methyl-1-[4-[7-(4-methylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-yl]piperidin-1-yl]-2-methylsulfanylpenta-2,4-dien-1-one.
| Compound Name | (2Z)-4-methyl-1-[4-[7-(4-methylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-yl]piperidin-1-yl]-2-methylsulfanylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 162748724 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (2Z)-4-methyl-1-[4-[7-(4-methylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-yl]piperidin-1-yl]-2-methylsulfanylpenta-2,4-dien-1-one |
| SMILES | C=C(C)/C=C(\SC)C(=O)N1CCC(c2ncnc3cc(N4CCN(C)CC4)cnc23)CC1 |
| InChI | InChI=1S/C24H32N6OS/c1-17(2)13-21(32-4)24(31)30-7-5-18(6-8-30)22-23-20(26-16-27-22)14-19(15-25-23)29-11-9-28(3)10-12-29/h13-16,18H,1,5-12H2,2-4H3/b21-13- |
| InChIKey | AHGNQEQGBPDJTA-BKUYFWCQSA-N |
| XLogP | 3.31 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|