About ethane;1-ethyl-2,3,5-trimethylpyrrole
ethane;1-ethyl-2,3,5-trimethylpyrrole (PubChem CID 162748917) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is ethane;1-ethyl-2,3,5-trimethylpyrrole.
Molecular Properties
| Compound Name | ethane;1-ethyl-2,3,5-trimethylpyrrole |
| PubChem CID | 162748917 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | ethane;1-ethyl-2,3,5-trimethylpyrrole |
| SMILES | CC.CC.CCn1c(C)cc(C)c1C |
| InChI | InChI=1S/C9H15N.2C2H6/c1-5-10-8(3)6-7(2)9(10)4;2*1-2/h6H,5H2,1-4H3;2*1-2H3 |
| InChIKey | YVTHJTOQBSPXGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-2,3,5-trimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2,3,5-trimethylpyrrole?
The IUPAC name of ethane;1-ethyl-2,3,5-trimethylpyrrole (CID 162748917) is ethane;1-ethyl-2,3,5-trimethylpyrrole.
What is the SMILES notation for ethane;1-ethyl-2,3,5-trimethylpyrrole?
The canonical SMILES for ethane;1-ethyl-2,3,5-trimethylpyrrole is CC.CC.CCn1c(C)cc(C)c1C.
What is the InChIKey of ethane;1-ethyl-2,3,5-trimethylpyrrole?
The InChIKey is YVTHJTOQBSPXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.2C2H6/c1-5-10-8(3)6-7(2)9(10)4;2*1-2/h6H,5H2,1-4H3;2*1-2H3.
What are the key properties of ethane;1-ethyl-2,3,5-trimethylpyrrole?
ethane;1-ethyl-2,3,5-trimethylpyrrole has a molecular weight of 197.37 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2,3,5-trimethylpyrrole is sourced from PubChem (CID 162748917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).