C20H27FN4O5 — CID 162749059
tert-butyl 4-[5-fluoro-2-(1-hydroxy-2-nitroethyl)-1-methylpyrrolo[2,3-b]pyridin-4-yl]piperidine-1-carboxylate (PubChem CID 162749059) has the molecular formula C20H27FN4O5 and a molecular weight of 422.46 g/mol. Its IUPAC name is tert-butyl 4-[5-fluoro-2-(1-hydroxy-2-nitroethyl)-1-methylpyrrolo[2,3-b]pyridin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-fluoro-2-(1-hydroxy-2-nitroethyl)-1-methylpyrrolo[2,3-b]pyridin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162749059 |
| Molecular Formula | C20H27FN4O5 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl 4-[5-fluoro-2-(1-hydroxy-2-nitroethyl)-1-methylpyrrolo[2,3-b]pyridin-4-yl]piperidine-1-carboxylate |
| SMILES | Cn1c(C(O)C[N+](=O)[O-])cc2c(C3CCN(C(=O)OC(C)(C)C)CC3)c(F)cnc21 |
| InChI | InChI=1S/C20H27FN4O5/c1-20(2,3)30-19(27)24-7-5-12(6-8-24)17-13-9-15(16(26)11-25(28)29)23(4)18(13)22-10-14(17)21/h9-10,12,16,26H,5-8,11H2,1-4H3 |
| InChIKey | XZHNXZMJLYLBOT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|