About methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate
methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate (PubChem CID 162749981) has the molecular formula C15H22N2O5S
and a molecular weight of 342.42 g/mol. Its IUPAC name is methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate |
| PubChem CID | 162749981 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate |
| SMILES | CO.COC(=O)c1ccc(SN[C@H]2CN[C@H](C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C14H18N2O4S.CH4O/c1-19-13(17)9-3-5-11(6-4-9)21-16-10-7-12(15-8-10)14(18)20-2;1-2/h3-6,10,12,15-16H,7-8H2,1-2H3;2H,1H3/t10-,12+;/m1./s1 |
| InChIKey | BRGSFEASPUDSND-IYJPBCIQSA-N |
| XLogP | 0.58 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate?
The IUPAC name of methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate (CID 162749981) is methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate.
What is the SMILES notation for methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate?
The canonical SMILES for methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate is CO.COC(=O)c1ccc(SN[C@H]2CN[C@H](C(=O)OC)C2)cc1.
What is the InChIKey of methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate?
The InChIKey is BRGSFEASPUDSND-IYJPBCIQSA-N. The full InChI is InChI=1S/C14H18N2O4S.CH4O/c1-19-13(17)9-3-5-11(6-4-9)21-16-10-7-12(15-8-10)14(18)20-2;1-2/h3-6,10,12,15-16H,7-8H2,1-2H3;2H,1H3/t10-,12+;/m1./s1.
What are the key properties of methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate?
methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate has a molecular weight of 342.42 g/mol, XLogP of 0.58, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl (2S,4R)-4-[(4-methoxycarbonylphenyl)sulfanylamino]pyrrolidine-2-carboxylate is sourced from PubChem (CID 162749981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).