C15H28N2O2S — CID 162749983
ethane;N-(1-ethylpiperidin-3-yl)benzenesulfonamide;molecular hydrogen (PubChem CID 162749983) has the molecular formula C15H28N2O2S and a molecular weight of 300.47 g/mol. Its IUPAC name is ethane;N-(1-ethylpiperidin-3-yl)benzenesulfonamide;molecular hydrogen.
| Compound Name | ethane;N-(1-ethylpiperidin-3-yl)benzenesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 162749983 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | ethane;N-(1-ethylpiperidin-3-yl)benzenesulfonamide;molecular hydrogen |
| SMILES | CC.CCN1CCCC(NS(=O)(=O)c2ccccc2)C1.[H][H] |
| InChI | InChI=1S/C13H20N2O2S.C2H6.H2/c1-2-15-10-6-7-12(11-15)14-18(16,17)13-8-4-3-5-9-13;1-2;/h3-5,8-9,12,14H,2,6-7,10-11H2,1H3;1-2H3;1H |
| InChIKey | CRWZCIGOTYKLAX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |