C18H16Cl2N2O3 — CID 162750667
3-(4,7-dichloroquinolin-2-yl)-5-methoxybenzoic acid;methanamine (PubChem CID 162750667) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 3-(4,7-dichloroquinolin-2-yl)-5-methoxybenzoic acid;methanamine.
| Compound Name | 3-(4,7-dichloroquinolin-2-yl)-5-methoxybenzoic acid;methanamine |
|---|---|
| PubChem CID | 162750667 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 3-(4,7-dichloroquinolin-2-yl)-5-methoxybenzoic acid;methanamine |
| SMILES | CN.COc1cc(C(=O)O)cc(-c2cc(Cl)c3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C17H11Cl2NO3.CH5N/c1-23-12-5-9(4-10(6-12)17(21)22)15-8-14(19)13-3-2-11(18)7-16(13)20-15;1-2/h2-8H,1H3,(H,21,22);2H2,1H3 |
| InChIKey | AYLVRNRPAYWZEU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |