C16H36N2O3 — CID 162750966
2-acetamido-3-methylbutanoic acid;ethane;1-methylpyrrolidine (PubChem CID 162750966) has the molecular formula C16H36N2O3 and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-acetamido-3-methylbutanoic acid;ethane;1-methylpyrrolidine.
| Compound Name | 2-acetamido-3-methylbutanoic acid;ethane;1-methylpyrrolidine |
|---|---|
| PubChem CID | 162750966 |
| Molecular Formula | C16H36N2O3 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.27 |
| IUPAC Name | 2-acetamido-3-methylbutanoic acid;ethane;1-methylpyrrolidine |
| SMILES | CC.CC.CC(=O)NC(C(=O)O)C(C)C.CN1CCCC1 |
| InChI | InChI=1S/C7H13NO3.C5H11N.2C2H6/c1-4(2)6(7(10)11)8-5(3)9;1-6-4-2-3-5-6;2*1-2/h4,6H,1-3H3,(H,8,9)(H,10,11);2-5H2,1H3;2*1-2H3 |
| InChIKey | ZLDMFJYBGMTUAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |