About 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid
7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid (PubChem CID 162751331) has the molecular formula C21H24Cl2N4O3
and a molecular weight of 451.35 g/mol. Its IUPAC name is 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid.
Molecular Properties
| Compound Name | 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid |
| PubChem CID | 162751331 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid |
| SMILES | COCCC(=O)O.Clc1ccc2c(-c3cn[nH]c3)cc(N3CCCCC3)nc2c1Cl |
| InChI | InChI=1S/C17H16Cl2N4.C4H8O3/c18-14-5-4-12-13(11-9-20-21-10-11)8-15(22-17(12)16(14)19)23-6-2-1-3-7-23;1-7-3-2-4(5)6/h4-5,8-10H,1-3,6-7H2,(H,20,21);2-3H2,1H3,(H,5,6) |
| InChIKey | DVHBOCOPWSJAJJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid?
The IUPAC name of 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid (CID 162751331) is 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid.
What is the SMILES notation for 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid?
The canonical SMILES for 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid is COCCC(=O)O.Clc1ccc2c(-c3cn[nH]c3)cc(N3CCCCC3)nc2c1Cl.
What is the InChIKey of 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid?
The InChIKey is DVHBOCOPWSJAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N4.C4H8O3/c18-14-5-4-12-13(11-9-20-21-10-11)8-15(22-17(12)16(14)19)23-6-2-1-3-7-23;1-7-3-2-4(5)6/h4-5,8-10H,1-3,6-7H2,(H,20,21);2-3H2,1H3,(H,5,6).
What are the key properties of 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid?
7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid has a molecular weight of 451.35 g/mol, XLogP of 5.03, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dichloro-2-piperidin-1-yl-4-(1H-pyrazol-4-yl)quinoline;3-methoxypropanoic acid is sourced from PubChem (CID 162751331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).