C13H7BrClF4NO2S — CID 162751860
2-bromo-N-[(2-chlorophenyl)methyl]-3,4,5,6-tetrafluorobenzenesulfonamide (PubChem CID 162751860) has the molecular formula C13H7BrClF4NO2S and a molecular weight of 432.62 g/mol. Its IUPAC name is 2-bromo-N-[(2-chlorophenyl)methyl]-3,4,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-[(2-chlorophenyl)methyl]-3,4,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 162751860 |
| Molecular Formula | C13H7BrClF4NO2S |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | 2-bromo-N-[(2-chlorophenyl)methyl]-3,4,5,6-tetrafluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1Cl)c1c(F)c(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C13H7BrClF4NO2S/c14-8-9(16)10(17)11(18)12(19)13(8)23(21,22)20-5-6-3-1-2-4-7(6)15/h1-4,20H,5H2 |
| InChIKey | WOOZZDUZZSPORA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|