C33H33ClN11O6+ — CID 162752136
methyl 4-[3-[3-[(1-amino-6-hydrazinylpyridazin-1-ium-3-carbonyl)amino]-4-ethoxycarbonylphenyl]propyl]-5-chloro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate (PubChem CID 162752136) has the molecular formula C33H33ClN11O6+ and a molecular weight of 715.15 g/mol. Its IUPAC name is methyl 4-[3-[3-[(1-amino-6-hydrazinylpyridazin-1-ium-3-carbonyl)amino]-4-ethoxycarbonylphenyl]propyl]-5-chloro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[3-[3-[(1-amino-6-hydrazinylpyridazin-1-ium-3-carbonyl)amino]-4-ethoxycarbonylphenyl]propyl]-5-chloro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 162752136 |
| Molecular Formula | C33H33ClN11O6+ |
| Molecular Weight | 715.15 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | methyl 4-[3-[3-[(1-amino-6-hydrazinylpyridazin-1-ium-3-carbonyl)amino]-4-ethoxycarbonylphenyl]propyl]-5-chloro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(CCCc2cc(NC(=O)c3ccc(-n4ccnc4)nn3)c(C(=O)OC)cc2Cl)cc1NC(=O)c1ccc(NN)[n+](N)n1 |
| InChI | InChI=1S/C33H32ClN11O6/c1-3-51-33(49)21-8-7-19(15-26(21)38-31(47)25-10-11-28(40-35)45(36)43-25)5-4-6-20-16-27(22(17-23(20)34)32(48)50-2)39-30(46)24-9-12-29(42-41-24)44-14-13-37-18-44/h7-18H,3-6,36H2,1-2H3,(H4,35,38,39,43,46,47,48,49)/p+1 |
| InChIKey | DZNINNHDOXBHDO-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 235.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|