C21H20F5N5O2 — CID 162753166
3-hydroxy-N,2-dimethyl-N-[4-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]iminomethyl]phenyl]propanamide (PubChem CID 162753166) has the molecular formula C21H20F5N5O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is 3-hydroxy-N,2-dimethyl-N-[4-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]iminomethyl]phenyl]propanamide.
| Compound Name | 3-hydroxy-N,2-dimethyl-N-[4-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]iminomethyl]phenyl]propanamide |
|---|---|
| PubChem CID | 162753166 |
| Molecular Formula | C21H20F5N5O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 3-hydroxy-N,2-dimethyl-N-[4-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazolo[3,4-c]pyridin-5-yl]iminomethyl]phenyl]propanamide |
| SMILES | CC(CO)C(=O)N(C)c1ccc(/C=N/c2cc3cnn(CC(F)(F)C(F)(F)F)c3cn2)cc1 |
| InChI | InChI=1S/C21H20F5N5O2/c1-13(11-32)19(33)30(2)16-5-3-14(4-6-16)8-27-18-7-15-9-29-31(17(15)10-28-18)12-20(22,23)21(24,25)26/h3-10,13,32H,11-12H2,1-2H3/b27-8+ |
| InChIKey | RKAOQUHTSZLECH-FLUNURKVSA-N |
| XLogP | 3.97 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|