About ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole
ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole (PubChem CID 162753392) has the molecular formula C13H26N4S2
and a molecular weight of 302.51 g/mol. Its IUPAC name is ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole |
| PubChem CID | 162753392 |
| Molecular Formula | C13H26N4S2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole |
| SMILES | CC.CCc1nsc(SCCCN2CCNCC2)n1 |
| InChI | InChI=1S/C11H20N4S2.C2H6/c1-2-10-13-11(17-14-10)16-9-3-6-15-7-4-12-5-8-15;1-2/h12H,2-9H2,1H3;1-2H3 |
| InChIKey | WDDXZCFXQQKVSG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole?
The IUPAC name of ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole (CID 162753392) is ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole.
What is the SMILES notation for ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole?
The canonical SMILES for ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole is CC.CCc1nsc(SCCCN2CCNCC2)n1.
What is the InChIKey of ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole?
The InChIKey is WDDXZCFXQQKVSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4S2.C2H6/c1-2-10-13-11(17-14-10)16-9-3-6-15-7-4-12-5-8-15;1-2/h12H,2-9H2,1H3;1-2H3.
What are the key properties of ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole?
ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole has a molecular weight of 302.51 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-5-(3-piperazin-1-ylpropylsulfanyl)-1,2,4-thiadiazole is sourced from PubChem (CID 162753392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).