C15H12N4S2 — CID 162753485
N-benzyl-5-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 162753485) has the molecular formula C15H12N4S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-benzyl-5-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | N-benzyl-5-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 162753485 |
| Molecular Formula | C15H12N4S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-benzyl-5-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | c1ccc(CNc2nn3c(-c4cccs4)cnc3s2)cc1 |
| InChI | InChI=1S/C15H12N4S2/c1-2-5-11(6-3-1)9-16-14-18-19-12(10-17-15(19)21-14)13-7-4-8-20-13/h1-8,10H,9H2,(H,16,18) |
| InChIKey | DUXUJQKOFIVVRX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |